C27H26Cl2N4O — CID 69237876
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[2-(3-methylphenyl)quinolin-4-yl]urea (PubChem CID 69237876) has the molecular formula C27H26Cl2N4O and a molecular weight of 493.44 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[2-(3-methylphenyl)quinolin-4-yl]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[2-(3-methylphenyl)quinolin-4-yl]urea |
|---|---|
| PubChem CID | 69237876 |
| Molecular Formula | C27H26Cl2N4O |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[2-(3-methylphenyl)quinolin-4-yl]urea |
| SMILES | Cc1cccc(-c2cc(NC(=O)Nc3ccc(N(CCCl)CCCl)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C27H26Cl2N4O/c1-19-5-4-6-20(17-19)25-18-26(23-7-2-3-8-24(23)31-25)32-27(34)30-21-9-11-22(12-10-21)33(15-13-28)16-14-29/h2-12,17-18H,13-16H2,1H3,(H2,30,31,32,34) |
| InChIKey | OZKLGARNAYXMFU-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|