C29H22N4O — CID 4657048
2-(3-methylphenyl)-N-(4-phenyldiazenylphenyl)quinoline-4-carboxamide (PubChem CID 4657048) has the molecular formula C29H22N4O and a molecular weight of 442.52 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-(4-phenyldiazenylphenyl)quinoline-4-carboxamide.
| Compound Name | 2-(3-methylphenyl)-N-(4-phenyldiazenylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4657048 |
| Molecular Formula | C29H22N4O |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-(3-methylphenyl)-N-(4-phenyldiazenylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cccc(-c2cc(C(=O)Nc3ccc(/N=N/c4ccccc4)cc3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C29H22N4O/c1-20-8-7-9-21(18-20)28-19-26(25-12-5-6-13-27(25)31-28)29(34)30-22-14-16-24(17-15-22)33-32-23-10-3-2-4-11-23/h2-19H,1H3,(H,30,34)/b33-32+ |
| InChIKey | VNWLXYWTMWSXSQ-ULIFNZDWSA-N |
| XLogP | 7.88 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|