C46H34N6O4 — CID 4275596
2-(3-methoxyphenyl)-N-[3-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]-4-phenyldiazenylphenyl]quinoline-4-carboxamide (PubChem CID 4275596) has the molecular formula C46H34N6O4 and a molecular weight of 734.82 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-N-[3-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]-4-phenyldiazenylphenyl]quinoline-4-carboxamide.
| Compound Name | 2-(3-methoxyphenyl)-N-[3-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]-4-phenyldiazenylphenyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4275596 |
| Molecular Formula | C46H34N6O4 |
| Molecular Weight | 734.82 g/mol |
| Exact Mass | 734.26 |
| IUPAC Name | 2-(3-methoxyphenyl)-N-[3-[[2-(3-methoxyphenyl)quinoline-4-carbonyl]amino]-4-phenyldiazenylphenyl]quinoline-4-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)Nc3ccc(/N=N/c4ccccc4)c(NC(=O)c4cc(-c5cccc(OC)c5)nc5ccccc45)c3)c3ccccc3n2)c1 |
| InChI | InChI=1S/C46H34N6O4/c1-55-33-16-10-12-29(24-33)42-27-37(35-18-6-8-20-39(35)48-42)45(53)47-32-22-23-41(52-51-31-14-4-3-5-15-31)44(26-32)50-46(54)38-28-43(30-13-11-17-34(25-30)56-2)49-40-21-9-7-19-36(38)40/h3-28H,1-2H3,(H,47,53)(H,50,54)/b52-51+ |
| InChIKey | NLAPOIVZLONBCK-WYYOLBRMSA-N |
| XLogP | 11.05 |
| TPSA | 127.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.82 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|