C33H31Cl2N5O2 — CID 90682626
1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-methoxyanilino)-2-phenylquinolin-6-yl]urea (PubChem CID 90682626) has the molecular formula C33H31Cl2N5O2 and a molecular weight of 600.55 g/mol. Its IUPAC name is 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-methoxyanilino)-2-phenylquinolin-6-yl]urea.
| Compound Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-methoxyanilino)-2-phenylquinolin-6-yl]urea |
|---|---|
| PubChem CID | 90682626 |
| Molecular Formula | C33H31Cl2N5O2 |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | 1-[4-[bis(2-chloroethyl)amino]phenyl]-3-[4-(3-methoxyanilino)-2-phenylquinolin-6-yl]urea |
| SMILES | COc1cccc(Nc2cc(-c3ccccc3)nc3ccc(NC(=O)Nc4ccc(N(CCCl)CCCl)cc4)cc23)c1 |
| InChI | InChI=1S/C33H31Cl2N5O2/c1-42-28-9-5-8-25(20-28)36-32-22-31(23-6-3-2-4-7-23)39-30-15-12-26(21-29(30)32)38-33(41)37-24-10-13-27(14-11-24)40(18-16-34)19-17-35/h2-15,20-22H,16-19H2,1H3,(H,36,39)(H2,37,38,41) |
| InChIKey | MAAARGJOCYFUOS-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|