C34H32Cl2N6O6 — CID 91262311
carbamoyl 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-5-methoxyacridine-4-carboxylate (PubChem CID 91262311) has the molecular formula C34H32Cl2N6O6 and a molecular weight of 691.57 g/mol. Its IUPAC name is carbamoyl 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-5-methoxyacridine-4-carboxylate.
| Compound Name | carbamoyl 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-5-methoxyacridine-4-carboxylate |
|---|---|
| PubChem CID | 91262311 |
| Molecular Formula | C34H32Cl2N6O6 |
| Molecular Weight | 691.57 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | carbamoyl 9-[3-[[4-[bis(2-chloroethyl)amino]phenyl]carbamoylamino]-5-methoxyanilino]-5-methoxyacridine-4-carboxylate |
| SMILES | COc1cc(NC(=O)Nc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3cccc(OC)c3nc3c(C(=O)OC(N)=O)cccc23)c1 |
| InChI | InChI=1S/C34H32Cl2N6O6/c1-46-24-18-21(17-22(19-24)40-34(45)39-20-9-11-23(12-10-20)42(15-13-35)16-14-36)38-29-25-5-3-7-27(32(43)48-33(37)44)30(25)41-31-26(29)6-4-8-28(31)47-2/h3-12,17-19H,13-16H2,1-2H3,(H2,37,44)(H,38,41)(H2,39,40,45) |
| InChIKey | GBBBBPZBWSEDIL-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 157.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.57 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|