C32H30Cl2N4O3 — CID 44570831
[4-[bis(2-chloroethyl)amino]phenyl] N-[4-methoxy-3-[(4-methylacridin-9-yl)amino]phenyl]carbamate (PubChem CID 44570831) has the molecular formula C32H30Cl2N4O3 and a molecular weight of 589.52 g/mol. Its IUPAC name is [4-[bis(2-chloroethyl)amino]phenyl] N-[4-methoxy-3-[(4-methylacridin-9-yl)amino]phenyl]carbamate.
| Compound Name | [4-[bis(2-chloroethyl)amino]phenyl] N-[4-methoxy-3-[(4-methylacridin-9-yl)amino]phenyl]carbamate |
|---|---|
| PubChem CID | 44570831 |
| Molecular Formula | C32H30Cl2N4O3 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.17 |
| IUPAC Name | [4-[bis(2-chloroethyl)amino]phenyl] N-[4-methoxy-3-[(4-methylacridin-9-yl)amino]phenyl]carbamate |
| SMILES | COc1ccc(NC(=O)Oc2ccc(N(CCCl)CCCl)cc2)cc1Nc1c2ccccc2nc2c(C)cccc12 |
| InChI | InChI=1S/C32H30Cl2N4O3/c1-21-6-5-8-26-30(21)36-27-9-4-3-7-25(27)31(26)37-28-20-22(10-15-29(28)40-2)35-32(39)41-24-13-11-23(12-14-24)38(18-16-33)19-17-34/h3-15,20H,16-19H2,1-2H3,(H,35,39)(H,36,37) |
| InChIKey | MUXDTSNURGUAQQ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|