C36H36Cl2N4O5 — CID 25017284
[3-(acridin-9-ylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate (PubChem CID 25017284) has the molecular formula C36H36Cl2N4O5 and a molecular weight of 675.61 g/mol. Its IUPAC name is [3-(acridin-9-ylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate.
| Compound Name | [3-(acridin-9-ylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate |
|---|---|
| PubChem CID | 25017284 |
| Molecular Formula | C36H36Cl2N4O5 |
| Molecular Weight | 675.61 g/mol |
| Exact Mass | 674.21 |
| IUPAC Name | [3-(acridin-9-ylamino)-5-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]methyl [4-[bis(2-chloroethyl)amino]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(COC(=O)Oc2ccc(N(CCCl)CCCl)cc2)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C36H36Cl2N4O5/c1-36(2,3)47-34(43)40-26-21-24(23-45-35(44)46-28-14-12-27(13-15-28)42(18-16-37)19-17-38)20-25(22-26)39-33-29-8-4-6-10-31(29)41-32-11-7-5-9-30(32)33/h4-15,20-22H,16-19,23H2,1-3H3,(H,39,41)(H,40,43) |
| InChIKey | GBYBGQHUVXVRAQ-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.61 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|