C28H25N3O7 — CID 10414142
4-[3-(acridin-9-ylamino)-5-(3-carboxypropanoyloxymethyl)anilino]-4-oxobutanoic acid (PubChem CID 10414142) has the molecular formula C28H25N3O7 and a molecular weight of 515.52 g/mol. Its IUPAC name is 4-[3-(acridin-9-ylamino)-5-(3-carboxypropanoyloxymethyl)anilino]-4-oxobutanoic acid.
| Compound Name | 4-[3-(acridin-9-ylamino)-5-(3-carboxypropanoyloxymethyl)anilino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 10414142 |
| Molecular Formula | C28H25N3O7 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 4-[3-(acridin-9-ylamino)-5-(3-carboxypropanoyloxymethyl)anilino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)Nc1cc(COC(=O)CCC(=O)O)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C28H25N3O7/c32-24(9-10-25(33)34)29-18-13-17(16-38-27(37)12-11-26(35)36)14-19(15-18)30-28-20-5-1-3-7-22(20)31-23-8-4-2-6-21(23)28/h1-8,13-15H,9-12,16H2,(H,29,32)(H,30,31)(H,33,34)(H,35,36) |
| InChIKey | UYAHPJAYAPUFBJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 154.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|