C27H21FN4O2 — CID 87605863
1-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-3-(3-fluorophenyl)urea (PubChem CID 87605863) has the molecular formula C27H21FN4O2 and a molecular weight of 452.49 g/mol. Its IUPAC name is 1-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 87605863 |
| Molecular Formula | C27H21FN4O2 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-[3-(acridin-9-ylamino)-5-(hydroxymethyl)phenyl]-3-(3-fluorophenyl)urea |
| SMILES | O=C(Nc1cccc(F)c1)Nc1cc(CO)cc(Nc2c3ccccc3nc3ccccc23)c1 |
| InChI | InChI=1S/C27H21FN4O2/c28-18-6-5-7-19(14-18)30-27(34)31-21-13-17(16-33)12-20(15-21)29-26-22-8-1-3-10-24(22)32-25-11-4-2-9-23(25)26/h1-15,33H,16H2,(H,29,32)(H2,30,31,34) |
| InChIKey | LQFVRRFWQLDGSL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|