About 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride
1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride (PubChem CID 50987018) has the molecular formula C26H21ClN4O
and a molecular weight of 440.93 g/mol. Its IUPAC name is 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride.
Molecular Properties
| Compound Name | 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride |
| PubChem CID | 50987018 |
| Molecular Formula | C26H21ClN4O |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(Nc2c3ccccc3nc3ccccc23)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C26H20N4O.ClH/c31-26(28-18-8-2-1-3-9-18)29-20-16-14-19(15-17-20)27-25-21-10-4-6-12-23(21)30-24-13-7-5-11-22(24)25;/h1-17H,(H,27,30)(H2,28,29,31);1H |
| InChIKey | YYXQGNHRFBMLJX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride?
The IUPAC name of 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride (CID 50987018) is 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride.
What is the SMILES notation for 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride?
The canonical SMILES for 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride is O=C(Nc1ccccc1)Nc1ccc(Nc2c3ccccc3nc3ccccc23)cc1.[Cl-].[H+].
What is the InChIKey of 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride?
The InChIKey is YYXQGNHRFBMLJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N4O.ClH/c31-26(28-18-8-2-1-3-9-18)29-20-16-14-19(15-17-20)27-25-21-10-4-6-12-23(21)30-24-13-7-5-11-22(24)25;/h1-17H,(H,27,30)(H2,28,29,31);1H.
What are the key properties of 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride?
1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride has a molecular weight of 440.93 g/mol, XLogP of 3.89, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(acridin-9-ylamino)phenyl]-3-phenylurea;hydron;chloride is sourced from PubChem (CID 50987018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).