C27H21ClN4O2 — CID 127037354
1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-3-phenylurea (PubChem CID 127037354) has the molecular formula C27H21ClN4O2 and a molecular weight of 468.94 g/mol. Its IUPAC name is 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 127037354 |
| Molecular Formula | C27H21ClN4O2 |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 1-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-3-phenylurea |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(NC(=O)Nc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C27H21ClN4O2/c1-34-21-12-14-24-23(16-21)26(22-13-7-17(28)15-25(22)32-24)29-19-8-10-20(11-9-19)31-27(33)30-18-5-3-2-4-6-18/h2-16H,1H3,(H,29,32)(H2,30,31,33) |
| InChIKey | HVTFEKYFJDYLJP-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 75.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|