C27H29ClN4O2 — CID 90671328
3-[4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]piperazin-1-yl]propan-1-ol (PubChem CID 90671328) has the molecular formula C27H29ClN4O2 and a molecular weight of 477.01 g/mol. Its IUPAC name is 3-[4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 90671328 |
| Molecular Formula | C27H29ClN4O2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 3-[4-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]piperazin-1-yl]propan-1-ol |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(N4CCN(CCCO)CC4)cc3)c2c1 |
| InChI | InChI=1S/C27H29ClN4O2/c1-34-22-8-10-25-24(18-22)27(23-9-3-19(28)17-26(23)30-25)29-20-4-6-21(7-5-20)32-14-12-31(13-15-32)11-2-16-33/h3-10,17-18,33H,2,11-16H2,1H3,(H,29,30) |
| InChIKey | XVSREQBIRXIZKI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 60.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|