C27H30ClN5O2 — CID 155402885
2-[[4-(2-aminoethyl)piperazin-1-yl]methyl]-4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenol (PubChem CID 155402885) has the molecular formula C27H30ClN5O2 and a molecular weight of 492.02 g/mol. Its IUPAC name is 2-[[4-(2-aminoethyl)piperazin-1-yl]methyl]-4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenol.
| Compound Name | 2-[[4-(2-aminoethyl)piperazin-1-yl]methyl]-4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenol |
|---|---|
| PubChem CID | 155402885 |
| Molecular Formula | C27H30ClN5O2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 2-[[4-(2-aminoethyl)piperazin-1-yl]methyl]-4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenol |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(O)c(CN4CCN(CCN)CC4)c3)c2c1 |
| InChI | InChI=1S/C27H30ClN5O2/c1-35-21-4-6-24-23(16-21)27(22-5-2-19(28)15-25(22)31-24)30-20-3-7-26(34)18(14-20)17-33-12-10-32(9-8-29)11-13-33/h2-7,14-16,34H,8-13,17,29H2,1H3,(H,30,31) |
| InChIKey | PXRZXCYCAAMZMB-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|