C30H34ClN5O3 — CID 155402943
3-[4-[[5-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-hydroxyphenyl]methyl]piperazin-1-yl]-2,2-dimethylpropanamide (PubChem CID 155402943) has the molecular formula C30H34ClN5O3 and a molecular weight of 548.09 g/mol. Its IUPAC name is 3-[4-[[5-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-hydroxyphenyl]methyl]piperazin-1-yl]-2,2-dimethylpropanamide.
| Compound Name | 3-[4-[[5-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-hydroxyphenyl]methyl]piperazin-1-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 155402943 |
| Molecular Formula | C30H34ClN5O3 |
| Molecular Weight | 548.09 g/mol |
| Exact Mass | 547.24 |
| IUPAC Name | 3-[4-[[5-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-hydroxyphenyl]methyl]piperazin-1-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(O)c(CN4CCN(CC(C)(C)C(N)=O)CC4)c3)c2c1 |
| InChI | InChI=1S/C30H34ClN5O3/c1-30(2,29(32)38)18-36-12-10-35(11-13-36)17-19-14-21(5-9-27(19)37)33-28-23-7-4-20(31)15-26(23)34-25-8-6-22(39-3)16-24(25)28/h4-9,14-16,37H,10-13,17-18H2,1-3H3,(H2,32,38)(H,33,34) |
| InChIKey | CMMSWZJSQMFHOU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.09 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|