C29H24ClN9O — CID 46186895
2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-hydrazinyl-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 46186895) has the molecular formula C29H24ClN9O and a molecular weight of 550.03 g/mol. Its IUPAC name is 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-hydrazinyl-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-hydrazinyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46186895 |
| Molecular Formula | C29H24ClN9O |
| Molecular Weight | 550.03 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-N-[4-[(6-chloro-2-methoxyacridin-9-yl)amino]phenyl]-6-hydrazinyl-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(Nc4nc(NN)nc(Nc5ccccc5)n4)cc3)c2c1 |
| InChI | InChI=1S/C29H24ClN9O/c1-40-21-12-14-24-23(16-21)26(22-13-7-17(30)15-25(22)35-24)32-19-8-10-20(11-9-19)34-28-36-27(37-29(38-28)39-31)33-18-5-3-2-4-6-18/h2-16H,31H2,1H3,(H,32,35)(H3,33,34,36,37,38,39) |
| InChIKey | LYONNGHGTZAEOI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.03 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|