C22H19ClN2O2 — CID 155402944
4-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-ethylphenol (PubChem CID 155402944) has the molecular formula C22H19ClN2O2 and a molecular weight of 378.86 g/mol. Its IUPAC name is 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-ethylphenol.
| Compound Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-ethylphenol |
|---|---|
| PubChem CID | 155402944 |
| Molecular Formula | C22H19ClN2O2 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-2-ethylphenol |
| SMILES | CCc1cc(Nc2c3ccc(Cl)cc3nc3ccc(OC)cc23)ccc1O |
| InChI | InChI=1S/C22H19ClN2O2/c1-3-13-10-15(5-9-21(13)26)24-22-17-7-4-14(23)11-20(17)25-19-8-6-16(27-2)12-18(19)22/h4-12,26H,3H2,1-2H3,(H,24,25) |
| InChIKey | BDXVPYRYGLACNU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|