C26H22ClN5O3S — CID 5270854
4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 5270854) has the molecular formula C26H22ClN5O3S and a molecular weight of 520.01 g/mol. Its IUPAC name is 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 5270854 |
| Molecular Formula | C26H22ClN5O3S |
| Molecular Weight | 520.01 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 4-[(6-chloro-2-methoxyacridin-9-yl)amino]-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(S(=O)(=O)Nc4nc(C)cc(C)n4)cc3)c2c1 |
| InChI | InChI=1S/C26H22ClN5O3S/c1-15-12-16(2)29-26(28-15)32-36(33,34)20-8-5-18(6-9-20)30-25-21-10-4-17(27)13-24(21)31-23-11-7-19(35-3)14-22(23)25/h4-14H,1-3H3,(H,30,31)(H,28,29,32) |
| InChIKey | PYRONDXYOXZGPF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.01 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|