C25H17Cl2N3O2S — CID 127036798
4-chloro-N-[4-[(2-chloroacridin-9-yl)amino]phenyl]benzenesulfonamide (PubChem CID 127036798) has the molecular formula C25H17Cl2N3O2S and a molecular weight of 494.40 g/mol. Its IUPAC name is 4-chloro-N-[4-[(2-chloroacridin-9-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[4-[(2-chloroacridin-9-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 127036798 |
| Molecular Formula | C25H17Cl2N3O2S |
| Molecular Weight | 494.40 g/mol |
| Exact Mass | 493.04 |
| IUPAC Name | 4-chloro-N-[4-[(2-chloroacridin-9-yl)amino]phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2c3ccccc3nc3ccc(Cl)cc23)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H17Cl2N3O2S/c26-16-5-12-20(13-6-16)33(31,32)30-19-10-8-18(9-11-19)28-25-21-3-1-2-4-23(21)29-24-14-7-17(27)15-22(24)25/h1-15,30H,(H,28,29) |
| InChIKey | YJGYHHRJSQPSRR-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.40 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|