About N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide
N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide (PubChem CID 10050670) has the molecular formula C28H20N4O2S
and a molecular weight of 476.56 g/mol. Its IUPAC name is N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide |
| PubChem CID | 10050670 |
| Molecular Formula | C28H20N4O2S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Nc2c3ccccc3nc3c2ccc2cccnc23)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H20N4O2S/c33-35(34,22-8-2-1-3-9-22)32-21-15-13-20(14-16-21)30-27-23-10-4-5-11-25(23)31-28-24(27)17-12-19-7-6-18-29-26(19)28/h1-18,32H,(H,30,31) |
| InChIKey | KBDULNCVHZOXBS-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide?
The IUPAC name of N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide (CID 10050670) is N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide.
What is the SMILES notation for N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide?
The canonical SMILES for N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide is O=S(=O)(Nc1ccc(Nc2c3ccccc3nc3c2ccc2cccnc23)cc1)c1ccccc1.
What is the InChIKey of N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide?
The InChIKey is KBDULNCVHZOXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H20N4O2S/c33-35(34,22-8-2-1-3-9-22)32-21-15-13-20(14-16-21)30-27-23-10-4-5-11-25(23)31-28-24(27)17-12-19-7-6-18-29-26(19)28/h1-18,32H,(H,30,31).
What are the key properties of N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide?
N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide has a molecular weight of 476.56 g/mol, XLogP of 6.48, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(benzo[b][1,10]phenanthrolin-7-ylamino)phenyl]benzenesulfonamide is sourced from PubChem (CID 10050670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).