C22H16N4O2S2 — CID 10550689
4-(acridin-9-ylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 10550689) has the molecular formula C22H16N4O2S2 and a molecular weight of 432.53 g/mol. Its IUPAC name is 4-(acridin-9-ylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-(acridin-9-ylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 10550689 |
| Molecular Formula | C22H16N4O2S2 |
| Molecular Weight | 432.53 g/mol |
| Exact Mass | 432.07 |
| IUPAC Name | 4-(acridin-9-ylamino)-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(Nc2c3ccccc3nc3ccccc23)cc1 |
| InChI | InChI=1S/C22H16N4O2S2/c27-30(28,26-22-23-13-14-29-22)16-11-9-15(10-12-16)24-21-17-5-1-3-7-19(17)25-20-8-4-2-6-18(20)21/h1-14H,(H,23,26)(H,24,25) |
| InChIKey | SZLSPBAGYLLDRB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.53 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|