C22H21N7O4S2 — CID 162651286
1-(4-morpholin-4-ylquinazolin-2-yl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]urea (PubChem CID 162651286) has the molecular formula C22H21N7O4S2 and a molecular weight of 511.59 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylquinazolin-2-yl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]urea.
| Compound Name | 1-(4-morpholin-4-ylquinazolin-2-yl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 162651286 |
| Molecular Formula | C22H21N7O4S2 |
| Molecular Weight | 511.59 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | 1-(4-morpholin-4-ylquinazolin-2-yl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)Nc1nc(N2CCOCC2)c2ccccc2n1 |
| InChI | InChI=1S/C22H21N7O4S2/c30-21(24-15-5-7-16(8-6-15)35(31,32)28-22-23-9-14-34-22)27-20-25-18-4-2-1-3-17(18)19(26-20)29-10-12-33-13-11-29/h1-9,14H,10-13H2,(H,23,28)(H2,24,25,26,27,30) |
| InChIKey | DEWWEOOVJREFIM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.59 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |