C16H18N4O3S3 — CID 25046214
2-piperidin-1-yl-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 25046214) has the molecular formula C16H18N4O3S3 and a molecular weight of 410.55 g/mol. Its IUPAC name is 2-piperidin-1-yl-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-piperidin-1-yl-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 25046214 |
| Molecular Formula | C16H18N4O3S3 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-piperidin-1-yl-2-sulfanylidene-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)C(=S)N1CCCCC1 |
| InChI | InChI=1S/C16H18N4O3S3/c21-14(15(24)20-9-2-1-3-10-20)18-12-4-6-13(7-5-12)26(22,23)19-16-17-8-11-25-16/h4-8,11H,1-3,9-10H2,(H,17,19)(H,18,21) |
| InChIKey | RJYDWCWEQFHTTL-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|