C22H18N4O3S3 — CID 25046100
1-(4-phenoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 25046100) has the molecular formula C22H18N4O3S3 and a molecular weight of 482.61 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-phenoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25046100 |
| Molecular Formula | C22H18N4O3S3 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 1-(4-phenoxyphenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(NC(=S)Nc2ccc(Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H18N4O3S3/c27-32(28,26-22-23-14-15-31-22)20-12-8-17(9-13-20)25-21(30)24-16-6-10-19(11-7-16)29-18-4-2-1-3-5-18/h1-15H,(H,23,26)(H2,24,25,30) |
| InChIKey | VUKDJVAKLJLYOP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|