C21H16N4O4S2 — CID 90596616
3-pyridin-2-yloxy-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 90596616) has the molecular formula C21H16N4O4S2 and a molecular weight of 452.52 g/mol. Its IUPAC name is 3-pyridin-2-yloxy-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3-pyridin-2-yloxy-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 90596616 |
| Molecular Formula | C21H16N4O4S2 |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | 3-pyridin-2-yloxy-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1cccc(Oc2ccccn2)c1 |
| InChI | InChI=1S/C21H16N4O4S2/c26-20(15-4-3-5-17(14-15)29-19-6-1-2-11-22-19)24-16-7-9-18(10-8-16)31(27,28)25-21-23-12-13-30-21/h1-14H,(H,23,25)(H,24,26) |
| InChIKey | ICDNRYDPAYDBKC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |