C16H12ClFN4O2S3 — CID 25037471
1-(4-chloro-3-fluorophenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 25037471) has the molecular formula C16H12ClFN4O2S3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25037471 |
| Molecular Formula | C16H12ClFN4O2S3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-3-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc(NC(=S)Nc2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C16H12ClFN4O2S3/c17-13-6-3-11(9-14(13)18)21-15(25)20-10-1-4-12(5-2-10)27(23,24)22-16-19-7-8-26-16/h1-9H,(H,19,22)(H2,20,21,25) |
| InChIKey | SIBPFXQKMHTOFR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|