C18H13ClFN3O3S2 — CID 6176689
(E)-3-(2-chloro-6-fluorophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 6176689) has the molecular formula C18H13ClFN3O3S2 and a molecular weight of 437.91 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6176689 |
| Molecular Formula | C18H13ClFN3O3S2 |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1c(F)cccc1Cl)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H13ClFN3O3S2/c19-15-2-1-3-16(20)14(15)8-9-17(24)22-12-4-6-13(7-5-12)28(25,26)23-18-21-10-11-27-18/h1-11H,(H,21,23)(H,22,24)/b9-8+ |
| InChIKey | HDBHHSIBCQVFSQ-CMDGGOBGSA-N |
| XLogP | 4.39 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|