C19H13F4N3O3S2 — CID 72530804
3-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 72530804) has the molecular formula C19H13F4N3O3S2 and a molecular weight of 471.46 g/mol. Its IUPAC name is 3-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 72530804 |
| Molecular Formula | C19H13F4N3O3S2 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.03 |
| IUPAC Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1C(F)(F)F)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C19H13F4N3O3S2/c20-13-3-1-12(16(11-13)19(21,22)23)2-8-17(27)25-14-4-6-15(7-5-14)31(28,29)26-18-24-9-10-30-18/h1-11H,(H,24,26)(H,25,27) |
| InChIKey | UHGSIZQOWKMLKR-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|