C21H18ClFN4O3S — CID 1291564
(E)-3-(2-chloro-6-fluorophenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 1291564) has the molecular formula C21H18ClFN4O3S and a molecular weight of 460.92 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1291564 |
| Molecular Formula | C21H18ClFN4O3S |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.08 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)/C=C/c3c(F)cccc3Cl)cc2)nc(C)n1 |
| InChI | InChI=1S/C21H18ClFN4O3S/c1-13-12-20(25-14(2)24-13)27-31(29,30)16-8-6-15(7-9-16)26-21(28)11-10-17-18(22)4-3-5-19(17)23/h3-12H,1-2H3,(H,26,28)(H,24,25,27)/b11-10+ |
| InChIKey | HSVSROQDWSFDCX-ZHACJKMWSA-N |
| XLogP | 4.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|