C19H18ClN5O3S — CID 4803264
1-(2-chlorophenyl)-3-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]urea (PubChem CID 4803264) has the molecular formula C19H18ClN5O3S and a molecular weight of 431.91 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]urea.
| Compound Name | 1-(2-chlorophenyl)-3-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 4803264 |
| Molecular Formula | C19H18ClN5O3S |
| Molecular Weight | 431.91 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]urea |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3Cl)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H18ClN5O3S/c1-12-11-18(22-13(2)21-12)25-29(27,28)15-9-7-14(8-10-15)23-19(26)24-17-6-4-3-5-16(17)20/h3-11H,1-2H3,(H,21,22,25)(H2,23,24,26) |
| InChIKey | ARSLTDWRWPXDAX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.91 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |