C14H16N4O4S — CID 4586210
methyl N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamate (PubChem CID 4586210) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is methyl N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamate.
| Compound Name | methyl N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 4586210 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | methyl N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(S(=O)(=O)Nc2cc(C)nc(C)n2)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-9-8-13(16-10(2)15-9)18-23(20,21)12-6-4-11(5-7-12)17-14(19)22-3/h4-8H,1-3H3,(H,17,19)(H,15,16,18) |
| InChIKey | KDLWVJFFGNQLSB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |