C19H19N5O3S — CID 4563892
1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylurea (PubChem CID 4563892) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 4563892 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 1-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]-3-phenylurea |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)Nc3ccccc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C19H19N5O3S/c1-13-12-18(21-14(2)20-13)24-28(26,27)17-10-8-16(9-11-17)23-19(25)22-15-6-4-3-5-7-15/h3-12H,1-2H3,(H,20,21,24)(H2,22,23,25) |
| InChIKey | ZSSNMDMTVJSLSO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |