C25H28N4O3S — CID 1317013
3-(4-tert-butylphenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide (PubChem CID 1317013) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide.
| Compound Name | 3-(4-tert-butylphenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 1317013 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N-[4-[(2,6-dimethylpyrimidin-4-yl)sulfamoyl]phenyl]prop-2-enamide |
| SMILES | Cc1cc(NS(=O)(=O)c2ccc(NC(=O)C=Cc3ccc(C(C)(C)C)cc3)cc2)nc(C)n1 |
| InChI | InChI=1S/C25H28N4O3S/c1-17-16-23(27-18(2)26-17)29-33(31,32)22-13-11-21(12-14-22)28-24(30)15-8-19-6-9-20(10-7-19)25(3,4)5/h6-16H,1-5H3,(H,28,30)(H,26,27,29) |
| InChIKey | CKDRLPQLICHSCR-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|