C27H23N3O2S — CID 127036796
4-methyl-N-[4-[(2-methylacridin-9-yl)amino]phenyl]benzenesulfonamide (PubChem CID 127036796) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is 4-methyl-N-[4-[(2-methylacridin-9-yl)amino]phenyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[4-[(2-methylacridin-9-yl)amino]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 127036796 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 4-methyl-N-[4-[(2-methylacridin-9-yl)amino]phenyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(Nc3c4ccccc4nc4ccc(C)cc34)cc2)cc1 |
| InChI | InChI=1S/C27H23N3O2S/c1-18-7-14-22(15-8-18)33(31,32)30-21-12-10-20(11-13-21)28-27-23-5-3-4-6-25(23)29-26-16-9-19(2)17-24(26)27/h3-17,30H,1-2H3,(H,28,29) |
| InChIKey | HSUFAVMAYZXGBV-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|