C20H16N2O3S — CID 3371014
N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzenesulfonamide (PubChem CID 3371014) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3371014 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzoxazol-2-yl)phenyl]benzenesulfonamide |
| SMILES | Cc1ccc2nc(-c3ccc(NS(=O)(=O)c4ccccc4)cc3)oc2c1 |
| InChI | InChI=1S/C20H16N2O3S/c1-14-7-12-18-19(13-14)25-20(21-18)15-8-10-16(11-9-15)22-26(23,24)17-5-3-2-4-6-17/h2-13,22H,1H3 |
| InChIKey | TTWVQGWTZYRHRZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |