C19H12ClFN2O3S — CID 146733141
N-[4-(6-chloro-1,3-benzoxazol-2-yl)phenyl]-4-fluorobenzenesulfonamide (PubChem CID 146733141) has the molecular formula C19H12ClFN2O3S and a molecular weight of 402.83 g/mol. Its IUPAC name is N-[4-(6-chloro-1,3-benzoxazol-2-yl)phenyl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[4-(6-chloro-1,3-benzoxazol-2-yl)phenyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 146733141 |
| Molecular Formula | C19H12ClFN2O3S |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | N-[4-(6-chloro-1,3-benzoxazol-2-yl)phenyl]-4-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2nc3ccc(Cl)cc3o2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H12ClFN2O3S/c20-13-3-10-17-18(11-13)26-19(22-17)12-1-6-15(7-2-12)23-27(24,25)16-8-4-14(21)5-9-16/h1-11,23H |
| InChIKey | RIOJLKMVQYZDQP-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |