C19H13FN2O3S — CID 155560132
N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzenesulfonamide (PubChem CID 155560132) has the molecular formula C19H13FN2O3S and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 155560132 |
| Molecular Formula | C19H13FN2O3S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-3-fluorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2nc3ccccc3o2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C19H13FN2O3S/c20-14-4-3-5-16(12-14)26(23,24)22-15-10-8-13(9-11-15)19-21-17-6-1-2-7-18(17)25-19/h1-12,22H |
| InChIKey | HAQMQDDWVQZFKC-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |