C19H12Cl2N2O3S — CID 155559479
N-[4-(1,3-benzoxazol-2-yl)phenyl]-3,4-dichlorobenzenesulfonamide (PubChem CID 155559479) has the molecular formula C19H12Cl2N2O3S and a molecular weight of 419.29 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-3,4-dichlorobenzenesulfonamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-3,4-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 155559479 |
| Molecular Formula | C19H12Cl2N2O3S |
| Molecular Weight | 419.29 g/mol |
| Exact Mass | 417.99 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-3,4-dichlorobenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H12Cl2N2O3S/c20-15-10-9-14(11-16(15)21)27(24,25)23-13-7-5-12(6-8-13)19-22-17-3-1-2-4-18(17)26-19/h1-11,23H |
| InChIKey | WJNJBGAMUIRGIV-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.29 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |