C20H13ClN2O5S — CID 58937205
5-[[4-(1,3-benzoxazol-2-yl)phenyl]sulfamoyl]-2-chlorobenzoic acid (PubChem CID 58937205) has the molecular formula C20H13ClN2O5S and a molecular weight of 428.85 g/mol. Its IUPAC name is 5-[[4-(1,3-benzoxazol-2-yl)phenyl]sulfamoyl]-2-chlorobenzoic acid.
| Compound Name | 5-[[4-(1,3-benzoxazol-2-yl)phenyl]sulfamoyl]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 58937205 |
| Molecular Formula | C20H13ClN2O5S |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 5-[[4-(1,3-benzoxazol-2-yl)phenyl]sulfamoyl]-2-chlorobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Nc2ccc(-c3nc4ccccc4o3)cc2)ccc1Cl |
| InChI | InChI=1S/C20H13ClN2O5S/c21-16-10-9-14(11-15(16)20(24)25)29(26,27)23-13-7-5-12(6-8-13)19-22-17-3-1-2-4-18(17)28-19/h1-11,23H,(H,24,25) |
| InChIKey | IODBLUYIDHVWSI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |