C25H17N5O9S2 — CID 134141423
3-nitro-N-[4-[5-[(3-nitrophenyl)sulfonylamino]-1,3-benzoxazol-2-yl]phenyl]benzenesulfonamide (PubChem CID 134141423) has the molecular formula C25H17N5O9S2 and a molecular weight of 595.57 g/mol. Its IUPAC name is 3-nitro-N-[4-[5-[(3-nitrophenyl)sulfonylamino]-1,3-benzoxazol-2-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[4-[5-[(3-nitrophenyl)sulfonylamino]-1,3-benzoxazol-2-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134141423 |
| Molecular Formula | C25H17N5O9S2 |
| Molecular Weight | 595.57 g/mol |
| Exact Mass | 595.05 |
| IUPAC Name | 3-nitro-N-[4-[5-[(3-nitrophenyl)sulfonylamino]-1,3-benzoxazol-2-yl]phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(-c3nc4cc(NS(=O)(=O)c5cccc([N+](=O)[O-])c5)ccc4o3)cc2)c1 |
| InChI | InChI=1S/C25H17N5O9S2/c31-29(32)19-3-1-5-21(14-19)40(35,36)27-17-9-7-16(8-10-17)25-26-23-13-18(11-12-24(23)39-25)28-41(37,38)22-6-2-4-20(15-22)30(33)34/h1-15,27-28H |
| InChIKey | HZTHWLZNEZZGCI-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 204.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|