C21H15N3O4S2 — CID 58874615
3-nitro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 58874615) has the molecular formula C21H15N3O4S2 and a molecular weight of 437.50 g/mol. Its IUPAC name is 3-nitro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 3-nitro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58874615 |
| Molecular Formula | C21H15N3O4S2 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | 3-nitro-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc2)c1 |
| InChI | InChI=1S/C21H15N3O4S2/c25-24(26)18-7-4-8-19(13-18)30(27,28)23-17-11-9-15(10-12-17)20-14-29-21(22-20)16-5-2-1-3-6-16/h1-14,23H |
| InChIKey | ROAOERBZDVMWQJ-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|