C22H18N2O3S2 — CID 1203751
4-methoxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 1203751) has the molecular formula C22H18N2O3S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 4-methoxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1203751 |
| Molecular Formula | C22H18N2O3S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 4-methoxy-N-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-c3csc(-c4ccccc4)n3)cc2)cc1 |
| InChI | InChI=1S/C22H18N2O3S2/c1-27-19-11-13-20(14-12-19)29(25,26)24-18-9-7-16(8-10-18)21-15-28-22(23-21)17-5-3-2-4-6-17/h2-15,24H,1H3 |
| InChIKey | MHTFASZZAVTSKN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |