C23H20N2O3S2 — CID 54774003
4-methoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide (PubChem CID 54774003) has the molecular formula C23H20N2O3S2 and a molecular weight of 436.56 g/mol. Its IUPAC name is 4-methoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54774003 |
| Molecular Formula | C23H20N2O3S2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 4-methoxy-N-[[4-(4-phenyl-1,3-thiazol-2-yl)phenyl]methyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2ccc(-c3nc(-c4ccccc4)cs3)cc2)cc1 |
| InChI | InChI=1S/C23H20N2O3S2/c1-28-20-11-13-21(14-12-20)30(26,27)24-15-17-7-9-19(10-8-17)23-25-22(16-29-23)18-5-3-2-4-6-18/h2-14,16,24H,15H2,1H3 |
| InChIKey | DYJYXRLROFEJOZ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |