C17H16N2O5S2 — CID 110393835
N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-4-methoxybenzenesulfonamide (PubChem CID 110393835) has the molecular formula C17H16N2O5S2 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 110393835 |
| Molecular Formula | C17H16N2O5S2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCc2nc(-c3ccc(O)c(O)c3)cs2)cc1 |
| InChI | InChI=1S/C17H16N2O5S2/c1-24-12-3-5-13(6-4-12)26(22,23)18-9-17-19-14(10-25-17)11-2-7-15(20)16(21)8-11/h2-8,10,18,20-21H,9H2,1H3 |
| InChIKey | BXNRBHCLCDKEJZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|