C16H16N2O4S3 — CID 110393844
N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-5-ethylthiophene-2-sulfonamide (PubChem CID 110393844) has the molecular formula C16H16N2O4S3 and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-5-ethylthiophene-2-sulfonamide.
| Compound Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-5-ethylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110393844 |
| Molecular Formula | C16H16N2O4S3 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]-5-ethylthiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCc2nc(-c3ccc(O)c(O)c3)cs2)s1 |
| InChI | InChI=1S/C16H16N2O4S3/c1-2-11-4-6-16(24-11)25(21,22)17-8-15-18-12(9-23-15)10-3-5-13(19)14(20)7-10/h3-7,9,17,19-20H,2,8H2,1H3 |
| InChIKey | UZOITTKZGIZRPG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|