C16H13ClN2O4S2 — CID 110393855
3-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzenesulfonamide (PubChem CID 110393855) has the molecular formula C16H13ClN2O4S2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 3-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110393855 |
| Molecular Formula | C16H13ClN2O4S2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | 3-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nc(-c2ccc(O)c(O)c2)cs1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H13ClN2O4S2/c17-11-2-1-3-12(7-11)25(22,23)18-8-16-19-13(9-24-16)10-4-5-14(20)15(21)6-10/h1-7,9,18,20-21H,8H2 |
| InChIKey | PXTGYNHDWKHHPR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|