C17H20N2O3S — CID 110393760
N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]cyclohexanecarboxamide (PubChem CID 110393760) has the molecular formula C17H20N2O3S and a molecular weight of 332.42 g/mol. Its IUPAC name is N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110393760 |
| Molecular Formula | C17H20N2O3S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]cyclohexanecarboxamide |
| SMILES | O=C(NCc1nc(-c2ccc(O)c(O)c2)cs1)C1CCCCC1 |
| InChI | InChI=1S/C17H20N2O3S/c20-14-7-6-12(8-15(14)21)13-10-23-16(19-13)9-18-17(22)11-4-2-1-3-5-11/h6-8,10-11,20-21H,1-5,9H2,(H,18,22) |
| InChIKey | MYFFZZFDFFUEBW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|