C25H31N5O3S — CID 177213743
(3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-pyrrolidin-1-ylethoxy)acetyl]piperidine-3-carboxamide (PubChem CID 177213743) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-pyrrolidin-1-ylethoxy)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-pyrrolidin-1-ylethoxy)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 177213743 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-pyrrolidin-1-ylethoxy)acetyl]piperidine-3-carboxamide |
| SMILES | N#Cc1ccc(-c2csc(CNC(=O)[C@H]3CCCN(C(=O)COCCN4CCCC4)C3)n2)cc1 |
| InChI | InChI=1S/C25H31N5O3S/c26-14-19-5-7-20(8-6-19)22-18-34-23(28-22)15-27-25(32)21-4-3-11-30(16-21)24(31)17-33-13-12-29-9-1-2-10-29/h5-8,18,21H,1-4,9-13,15-17H2,(H,27,32)/t21-/m0/s1 |
| InChIKey | GCMGALNIDKYUIL-NRFANRHFSA-N |
| XLogP | 2.65 |
| TPSA | 98.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|