C21H23FN4O3S — CID 177213583
(3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-fluoroethoxy)acetyl]piperidine-3-carboxamide (PubChem CID 177213583) has the molecular formula C21H23FN4O3S and a molecular weight of 430.51 g/mol. Its IUPAC name is (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-fluoroethoxy)acetyl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-fluoroethoxy)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 177213583 |
| Molecular Formula | C21H23FN4O3S |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (3S)-N-[[4-(4-cyanophenyl)-1,3-thiazol-2-yl]methyl]-1-[2-(2-fluoroethoxy)acetyl]piperidine-3-carboxamide |
| SMILES | N#Cc1ccc(-c2csc(CNC(=O)[C@H]3CCCN(C(=O)COCCF)C3)n2)cc1 |
| InChI | InChI=1S/C21H23FN4O3S/c22-7-9-29-13-20(27)26-8-1-2-17(12-26)21(28)24-11-19-25-18(14-30-19)16-5-3-15(10-23)4-6-16/h3-6,14,17H,1-2,7-9,11-13H2,(H,24,28)/t17-/m0/s1 |
| InChIKey | WLNWKGMCJYICMR-KRWDZBQOSA-N |
| XLogP | 2.52 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|