C17H13ClN2O3S — CID 110393799
2-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzamide (PubChem CID 110393799) has the molecular formula C17H13ClN2O3S and a molecular weight of 360.82 g/mol. Its IUPAC name is 2-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzamide.
| Compound Name | 2-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 110393799 |
| Molecular Formula | C17H13ClN2O3S |
| Molecular Weight | 360.82 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 2-chloro-N-[[4-(3,4-dihydroxyphenyl)-1,3-thiazol-2-yl]methyl]benzamide |
| SMILES | O=C(NCc1nc(-c2ccc(O)c(O)c2)cs1)c1ccccc1Cl |
| InChI | InChI=1S/C17H13ClN2O3S/c18-12-4-2-1-3-11(12)17(23)19-8-16-20-13(9-24-16)10-5-6-14(21)15(22)7-10/h1-7,9,21-22H,8H2,(H,19,23) |
| InChIKey | GSODQWQLMHSIMT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.82 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|