C13H23NO3S2 — CID 103835206
5-ethyl-N-(3-ethyl-2-hydroxypentyl)thiophene-2-sulfonamide (PubChem CID 103835206) has the molecular formula C13H23NO3S2 and a molecular weight of 305.47 g/mol. Its IUPAC name is 5-ethyl-N-(3-ethyl-2-hydroxypentyl)thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-(3-ethyl-2-hydroxypentyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103835206 |
| Molecular Formula | C13H23NO3S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 5-ethyl-N-(3-ethyl-2-hydroxypentyl)thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC(O)C(CC)CC)s1 |
| InChI | InChI=1S/C13H23NO3S2/c1-4-10(5-2)12(15)9-14-19(16,17)13-8-7-11(6-3)18-13/h7-8,10,12,14-15H,4-6,9H2,1-3H3 |
| InChIKey | HCWYVSSWSJLFCY-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |